C20H19N3O5 — CID 78779969
methyl 3-(1H-indol-3-yl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate (PubChem CID 78779969) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is methyl 3-(1H-indol-3-yl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate.
| Compound Name | methyl 3-(1H-indol-3-yl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 78779969 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 3-(1H-indol-3-yl)-2-[[2-(4-nitrophenyl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O5/c1-28-20(25)18(11-14-12-21-17-5-3-2-4-16(14)17)22-19(24)10-13-6-8-15(9-7-13)23(26)27/h2-9,12,18,21H,10-11H2,1H3,(H,22,24) |
| InChIKey | UXTKZSPMIUFSLO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|