C27H26N4O6 — CID 23881908
(4-nitrophenyl)methyl 3-(1H-indol-3-yl)-2-[(1,4,6-trimethyl-2-oxopyridine-3-carbonyl)amino]propanoate (PubChem CID 23881908) has the molecular formula C27H26N4O6 and a molecular weight of 502.53 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(1H-indol-3-yl)-2-[(1,4,6-trimethyl-2-oxopyridine-3-carbonyl)amino]propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-(1H-indol-3-yl)-2-[(1,4,6-trimethyl-2-oxopyridine-3-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 23881908 |
| Molecular Formula | C27H26N4O6 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(1H-indol-3-yl)-2-[(1,4,6-trimethyl-2-oxopyridine-3-carbonyl)amino]propanoate |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H26N4O6/c1-16-12-17(2)30(3)26(33)24(16)25(32)29-23(13-19-14-28-22-7-5-4-6-21(19)22)27(34)37-15-18-8-10-20(11-9-18)31(35)36/h4-12,14,23,28H,13,15H2,1-3H3,(H,29,32) |
| InChIKey | JYVBZSSDEHHBPE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 136.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|