C29H36N4O7 — CID 166640140
(4-nitrophenyl)methyl (2R)-2-[[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate (PubChem CID 166640140) has the molecular formula C29H36N4O7 and a molecular weight of 552.63 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (2R)-2-[[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate.
| Compound Name | (4-nitrophenyl)methyl (2R)-2-[[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate |
|---|---|
| PubChem CID | 166640140 |
| Molecular Formula | C29H36N4O7 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (4-nitrophenyl)methyl (2R)-2-[[(2R)-3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]hexanoate |
| SMILES | CCCC[C@@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C)C(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H36N4O7/c1-5-6-10-24(27(35)39-18-19-12-14-21(15-13-19)33(37)38)31-26(34)25(32-28(36)40-29(2,3)4)16-20-17-30-23-11-8-7-9-22(20)23/h7-9,11-15,17,24-25,30H,5-6,10,16,18H2,1-4H3,(H,31,34)(H,32,36)/t24-,25-/m1/s1 |
| InChIKey | ZEITZJHUEMPOQT-JWQCQUIFSA-N |
| XLogP | 4.93 |
| TPSA | 152.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|