C39H47N5O8 — CID 13391310
(2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 13391310) has the molecular formula C39H47N5O8 and a molecular weight of 713.83 g/mol. Its IUPAC name is (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 13391310 |
| Molecular Formula | C39H47N5O8 |
| Molecular Weight | 713.83 g/mol |
| Exact Mass | 713.34 |
| IUPAC Name | (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoyl]amino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C39H47N5O8/c1-39(2,3)52-38(50)44-32(22-26-14-6-4-7-15-26)34(45)43-33(23-28-24-41-30-19-11-10-18-29(28)30)35(46)42-31(36(47)48)20-12-13-21-40-37(49)51-25-27-16-8-5-9-17-27/h4-11,14-19,24,31-33,41H,12-13,20-23,25H2,1-3H3,(H,40,49)(H,42,46)(H,43,45)(H,44,50)(H,47,48)/t31-,32-,33+/m0/s1 |
| InChIKey | NMQRSHVFTVZLGF-XFCANUNOSA-N |
| XLogP | 5.00 |
| TPSA | 187.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.83 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|