C35H47N5O9 — CID 3130513
methyl 3-hydroxy-2-[[2-[[3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate (PubChem CID 3130513) has the molecular formula C35H47N5O9 and a molecular weight of 681.79 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[2-[[3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate.
| Compound Name | methyl 3-hydroxy-2-[[2-[[3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate |
|---|---|
| PubChem CID | 3130513 |
| Molecular Formula | C35H47N5O9 |
| Molecular Weight | 681.79 g/mol |
| Exact Mass | 681.34 |
| IUPAC Name | methyl 3-hydroxy-2-[[2-[[3-(1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-6-(phenylmethoxycarbonylamino)hexanoyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)C(CCCCNC(=O)OCc1ccccc1)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C)C(C)O |
| InChI | InChI=1S/C35H47N5O9/c1-22(41)29(32(44)47-5)40-30(42)27(17-11-12-18-36-33(45)48-21-23-13-7-6-8-14-23)38-31(43)28(39-34(46)49-35(2,3)4)19-24-20-37-26-16-10-9-15-25(24)26/h6-10,13-16,20,22,27-29,37,41H,11-12,17-19,21H2,1-5H3,(H,36,45)(H,38,43)(H,39,46)(H,40,42) |
| InChIKey | YFDCTGFDDUMDKJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 197.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.79 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|