C33H46N4O6 — CID 131724348
tert-butyl (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxyamino]hexanoate (PubChem CID 131724348) has the molecular formula C33H46N4O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxyamino]hexanoate.
| Compound Name | tert-butyl (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxyamino]hexanoate |
|---|---|
| PubChem CID | 131724348 |
| Molecular Formula | C33H46N4O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | tert-butyl (2S)-2-[[(2R)-3-(1H-indol-3-yl)-2-(phenylmethoxycarbonylamino)propanoyl]amino]-6-[(2-methylpropan-2-yl)oxyamino]hexanoate |
| SMILES | CC(C)(C)ONCCCC[C@H](NC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H46N4O6/c1-32(2,3)42-30(39)27(18-12-13-19-35-43-33(4,5)6)36-29(38)28(20-24-21-34-26-17-11-10-16-25(24)26)37-31(40)41-22-23-14-8-7-9-15-23/h7-11,14-17,21,27-28,34-35H,12-13,18-20,22H2,1-6H3,(H,36,38)(H,37,40)/t27-,28+/m0/s1 |
| InChIKey | MHALAAJYQVTTBJ-WUFINQPMSA-N |
| XLogP | 5.32 |
| TPSA | 130.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|