C23H26N4O5 — CID 2876044
tert-butyl N-[3-(1H-indol-3-yl)-1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 2876044) has the molecular formula C23H26N4O5 and a molecular weight of 438.48 g/mol. Its IUPAC name is tert-butyl N-[3-(1H-indol-3-yl)-1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-(1H-indol-3-yl)-1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 2876044 |
| Molecular Formula | C23H26N4O5 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | tert-butyl N-[3-(1H-indol-3-yl)-1-(2-methyl-5-nitroanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H26N4O5/c1-14-9-10-16(27(30)31)12-19(14)25-21(28)20(26-22(29)32-23(2,3)4)11-15-13-24-18-8-6-5-7-17(15)18/h5-10,12-13,20,24H,11H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | CZOPLGWHCRTSSA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 126.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|