C24H20N4O5 — CID 163707610
methyl (2S)-3-(1H-indol-3-yl)-2-[[5-(4-nitrophenyl)pyridine-2-carbonyl]amino]propanoate (PubChem CID 163707610) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is methyl (2S)-3-(1H-indol-3-yl)-2-[[5-(4-nitrophenyl)pyridine-2-carbonyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(1H-indol-3-yl)-2-[[5-(4-nitrophenyl)pyridine-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 163707610 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl (2S)-3-(1H-indol-3-yl)-2-[[5-(4-nitrophenyl)pyridine-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cn1 |
| InChI | InChI=1S/C24H20N4O5/c1-33-24(30)22(12-17-14-25-20-5-3-2-4-19(17)20)27-23(29)21-11-8-16(13-26-21)15-6-9-18(10-7-15)28(31)32/h2-11,13-14,22,25H,12H2,1H3,(H,27,29)/t22-/m0/s1 |
| InChIKey | KGKXGBNHOVIKEE-QFIPXVFZSA-N |
| XLogP | 3.65 |
| TPSA | 127.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|