C17H16N2O3S — CID 6923544
methyl (2R)-3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 6923544) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is methyl (2R)-3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | methyl (2R)-3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 6923544 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | methyl (2R)-3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | COC(=O)[C@@H](Cc1c[nH]c2ccccc12)NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H16N2O3S/c1-22-17(21)14(19-16(20)15-7-4-8-23-15)9-11-10-18-13-6-3-2-5-12(11)13/h2-8,10,14,18H,9H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | YCSIDFGIJYGHKF-CQSZACIVSA-N |
| XLogP | 2.74 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |