C23H19ClN2O3S — CID 23738438
(2-chlorophenyl)methyl 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 23738438) has the molecular formula C23H19ClN2O3S and a molecular weight of 438.94 g/mol. Its IUPAC name is (2-chlorophenyl)methyl 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | (2-chlorophenyl)methyl 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 23738438 |
| Molecular Formula | C23H19ClN2O3S |
| Molecular Weight | 438.94 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | (2-chlorophenyl)methyl 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(NC(Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1Cl)c1cccs1 |
| InChI | InChI=1S/C23H19ClN2O3S/c24-18-8-3-1-6-15(18)14-29-23(28)20(26-22(27)21-10-5-11-30-21)12-16-13-25-19-9-4-2-7-17(16)19/h1-11,13,20,25H,12,14H2,(H,26,27) |
| InChIKey | OCQZVMYNHQPIDN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.94 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |