C20H22N2O3S — CID 33244587
methyl (2R)-2-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoate (PubChem CID 33244587) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is methyl (2R)-2-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl (2R)-2-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 33244587 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | methyl (2R)-2-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCc1cc(C(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)OC)sc1C |
| InChI | InChI=1S/C20H22N2O3S/c1-4-13-10-18(26-12(13)2)19(23)22-17(20(24)25-3)9-14-11-21-16-8-6-5-7-15(14)16/h5-8,10-11,17,21H,4,9H2,1-3H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | SXVQRDKZBNNRGB-QGZVFWFLSA-N |
| XLogP | 3.61 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |