C24H20N4O6S — CID 3624220
[2-(4-nitroanilino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 3624220) has the molecular formula C24H20N4O6S and a molecular weight of 492.51 g/mol. Its IUPAC name is [2-(4-nitroanilino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-(4-nitroanilino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 3624220 |
| Molecular Formula | C24H20N4O6S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | [2-(4-nitroanilino)-2-oxoethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | O=C(COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1cccs1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N4O6S/c29-22(26-16-7-9-17(10-8-16)28(32)33)14-34-24(31)20(27-23(30)21-6-3-11-35-21)12-15-13-25-19-5-2-1-4-18(15)19/h1-11,13,20,25H,12,14H2,(H,26,29)(H,27,30) |
| InChIKey | AFCGFHYDMWFDEZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 143.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|