C22H22N4O5S — CID 42901430
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate (PubChem CID 42901430) has the molecular formula C22H22N4O5S and a molecular weight of 454.51 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 42901430 |
| Molecular Formula | C22H22N4O5S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 3-(1H-indol-3-yl)-2-(thiophene-2-carbonylamino)propanoate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)c1cccs1 |
| InChI | InChI=1S/C22H22N4O5S/c1-2-9-23-22(30)26-19(27)13-31-21(29)17(25-20(28)18-8-5-10-32-18)11-14-12-24-16-7-4-3-6-15(14)16/h2-8,10,12,17,24H,1,9,11,13H2,(H,25,28)(H2,23,26,27,30) |
| InChIKey | NLCFZRTZRBGCBC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|