C16H17N3O4 — CID 8896357
[2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 8896357) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 8896357 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | [2-oxo-2-(prop-2-enylcarbamoylamino)ethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | C=CCNC(=O)NC(=O)COC(=O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H17N3O4/c1-2-7-17-16(22)19-14(20)10-23-15(21)8-11-9-18-13-6-4-3-5-12(11)13/h2-6,9,18H,1,7-8,10H2,(H2,17,19,20,22) |
| InChIKey | JEOJZNJPWPHOKV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|