C21H25N3O4 — CID 7960087
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate (PubChem CID 7960087) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 7960087 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(COC(=O)Cc1c[nH]c2ccccc12)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H25N3O4/c25-19(24-21(27)22-11-10-15-6-2-1-3-7-15)14-28-20(26)12-16-13-23-18-9-5-4-8-17(16)18/h4-6,8-9,13,23H,1-3,7,10-12,14H2,(H2,22,24,25,27) |
| InChIKey | OXCVIBVRQMCCMN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|