C20H25FN2O5 — CID 8667448
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate (PubChem CID 8667448) has the molecular formula C20H25FN2O5 and a molecular weight of 392.43 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 8667448 |
| Molecular Formula | C20H25FN2O5 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2-(3-fluoro-4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)NC(=O)NCCC2=CCCCC2)cc1F |
| InChI | InChI=1S/C20H25FN2O5/c1-27-17-8-7-15(11-16(17)21)12-19(25)28-13-18(24)23-20(26)22-10-9-14-5-3-2-4-6-14/h5,7-8,11H,2-4,6,9-10,12-13H2,1H3,(H2,22,23,24,26) |
| InChIKey | SZTNABZUSRYHTC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|