C18H21ClN2O5 — CID 8604104
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate (PubChem CID 8604104) has the molecular formula C18H21ClN2O5 and a molecular weight of 380.83 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
|---|---|
| PubChem CID | 8604104 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 5-chloro-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Cl)ccc1O)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H21ClN2O5/c19-13-6-7-15(22)14(10-13)17(24)26-11-16(23)21-18(25)20-9-8-12-4-2-1-3-5-12/h4,6-7,10,22H,1-3,5,8-9,11H2,(H2,20,21,23,25) |
| InChIKey | TXZVHAFRAFWZON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|