C12H19ClN2O2 — CID 103603928
3-chloro-N-[2-(cyclohexen-1-yl)ethylcarbamoyl]propanamide (PubChem CID 103603928) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 3-chloro-N-[2-(cyclohexen-1-yl)ethylcarbamoyl]propanamide.
| Compound Name | 3-chloro-N-[2-(cyclohexen-1-yl)ethylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 103603928 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-chloro-N-[2-(cyclohexen-1-yl)ethylcarbamoyl]propanamide |
| SMILES | O=C(CCCl)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C12H19ClN2O2/c13-8-6-11(16)15-12(17)14-9-7-10-4-2-1-3-5-10/h4H,1-3,5-9H2,(H2,14,15,16,17) |
| InChIKey | PXDWLJVNVUMEAP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|