C11H17ClN2O2 — CID 106178247
2-chloro-N-[2-(cyclopenten-1-yl)ethylcarbamoyl]propanamide (PubChem CID 106178247) has the molecular formula C11H17ClN2O2 and a molecular weight of 244.72 g/mol. Its IUPAC name is 2-chloro-N-[2-(cyclopenten-1-yl)ethylcarbamoyl]propanamide.
| Compound Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethylcarbamoyl]propanamide |
|---|---|
| PubChem CID | 106178247 |
| Molecular Formula | C11H17ClN2O2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-chloro-N-[2-(cyclopenten-1-yl)ethylcarbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NCCC1=CCCC1 |
| InChI | InChI=1S/C11H17ClN2O2/c1-8(12)10(15)14-11(16)13-7-6-9-4-2-3-5-9/h4,8H,2-3,5-7H2,1H3,(H2,13,14,15,16) |
| InChIKey | XZANVMIRIOKMDB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|