C13H22N2O4 — CID 107855964
(2S,3R)-2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-3-hydroxybutanoic acid (PubChem CID 107855964) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is (2S,3R)-2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107855964 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | (2S,3R)-2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)NCCC1=CCCCC1)C(=O)O |
| InChI | InChI=1S/C13H22N2O4/c1-9(16)11(12(17)18)15-13(19)14-8-7-10-5-3-2-4-6-10/h5,9,11,16H,2-4,6-8H2,1H3,(H,17,18)(H2,14,15,19)/t9-,11+/m1/s1 |
| InChIKey | FXEXYUCYDJEUSH-KOLCDFICSA-N |
| XLogP | 1.01 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|