C12H19NO4 — CID 104964499
(2S,3R)-2-[[2-(cyclohexen-1-yl)acetyl]amino]-3-hydroxybutanoic acid (PubChem CID 104964499) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (2S,3R)-2-[[2-(cyclohexen-1-yl)acetyl]amino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[2-(cyclohexen-1-yl)acetyl]amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104964499 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (2S,3R)-2-[[2-(cyclohexen-1-yl)acetyl]amino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)CC1=CCCCC1)C(=O)O |
| InChI | InChI=1S/C12H19NO4/c1-8(14)11(12(16)17)13-10(15)7-9-5-3-2-4-6-9/h5,8,11,14H,2-4,6-7H2,1H3,(H,13,15)(H,16,17)/t8-,11+/m1/s1 |
| InChIKey | SSVHHBSOUVWGLM-KCJUWKMLSA-N |
| XLogP | 0.83 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|