C12H19NO3 — CID 63564809
methyl 2-[[2-(cyclohexen-1-yl)acetyl]amino]propanoate (PubChem CID 63564809) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is methyl 2-[[2-(cyclohexen-1-yl)acetyl]amino]propanoate.
| Compound Name | methyl 2-[[2-(cyclohexen-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 63564809 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | methyl 2-[[2-(cyclohexen-1-yl)acetyl]amino]propanoate |
| SMILES | COC(=O)C(C)NC(=O)CC1=CCCCC1 |
| InChI | InChI=1S/C12H19NO3/c1-9(12(15)16-2)13-11(14)8-10-6-4-3-5-7-10/h6,9H,3-5,7-8H2,1-2H3,(H,13,14) |
| InChIKey | OUBKVDRMUTZKFK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|