C18H31N3O2 — CID 18084867
N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(3,5-dimethylpiperidin-1-yl)acetamide (PubChem CID 18084867) has the molecular formula C18H31N3O2 and a molecular weight of 321.47 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(3,5-dimethylpiperidin-1-yl)acetamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(3,5-dimethylpiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 18084867 |
| Molecular Formula | C18H31N3O2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethylcarbamoyl]-2-(3,5-dimethylpiperidin-1-yl)acetamide |
| SMILES | CC1CC(C)CN(CC(=O)NC(=O)NCCC2=CCCCC2)C1 |
| InChI | InChI=1S/C18H31N3O2/c1-14-10-15(2)12-21(11-14)13-17(22)20-18(23)19-9-8-16-6-4-3-5-7-16/h6,14-15H,3-5,7-13H2,1-2H3,(H2,19,20,22,23) |
| InChIKey | JDFPZSNUSVPXNG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|