C21H26N2O4 — CID 9010058
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2,3-dihydro-1H-indene-5-carboxylate (PubChem CID 9010058) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2,3-dihydro-1H-indene-5-carboxylate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2,3-dihydro-1H-indene-5-carboxylate |
|---|---|
| PubChem CID | 9010058 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] 2,3-dihydro-1H-indene-5-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2c(c1)CCC2)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C21H26N2O4/c24-19(23-21(26)22-12-11-15-5-2-1-3-6-15)14-27-20(25)18-10-9-16-7-4-8-17(16)13-18/h5,9-10,13H,1-4,6-8,11-12,14H2,(H2,22,23,24,26) |
| InChIKey | JCRNZYYVQABZEX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|