C18H21F2NO4 — CID 2612442
[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(difluoromethoxy)benzoate (PubChem CID 2612442) has the molecular formula C18H21F2NO4 and a molecular weight of 353.37 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2612442 |
| Molecular Formula | C18H21F2NO4 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl] 4-(difluoromethoxy)benzoate |
| SMILES | O=C(COC(=O)c1ccc(OC(F)F)cc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H21F2NO4/c19-18(20)25-15-8-6-14(7-9-15)17(23)24-12-16(22)21-11-10-13-4-2-1-3-5-13/h4,6-9,18H,1-3,5,10-12H2,(H,21,22) |
| InChIKey | MFBCMSVBRDRKSX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|