C11H11F2NO4 — CID 7569623
[2-(methylamino)-2-oxoethyl] 4-(difluoromethoxy)benzoate (PubChem CID 7569623) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 7569623 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
| SMILES | CNC(=O)COC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C11H11F2NO4/c1-14-9(15)6-17-10(16)7-2-4-8(5-3-7)18-11(12)13/h2-5,11H,6H2,1H3,(H,14,15) |
| InChIKey | ISQDEWCUDIUFFB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |