C22H20F2N2O4 — CID 7274917
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 7274917) has the molecular formula C22H20F2N2O4 and a molecular weight of 414.41 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 7274917 |
| Molecular Formula | C22H20F2N2O4 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)OCC(=O)Nc2ccc(OC(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H20F2N2O4/c1-14-3-4-15(2)26(14)18-9-5-16(6-10-18)21(28)29-13-20(27)25-17-7-11-19(12-8-17)30-22(23)24/h3-12,22H,13H2,1-2H3,(H,25,27) |
| InChIKey | LMSYPBWTQQZSOX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|