C20H18F2N2O4 — CID 41120554
[2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 41120554) has the molecular formula C20H18F2N2O4 and a molecular weight of 388.37 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 41120554 |
| Molecular Formula | C20H18F2N2O4 |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [2-[4-(difluoromethoxy)anilino]-2-oxoethyl] 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OCC(=O)Nc3ccc(OC(F)F)cc3)cc2c1C |
| InChI | InChI=1S/C20H18F2N2O4/c1-11-12(2)23-17-8-3-13(9-16(11)17)19(26)27-10-18(25)24-14-4-6-15(7-5-14)28-20(21)22/h3-9,20,23H,10H2,1-2H3,(H,24,25) |
| InChIKey | MWQUNCJGNXUHBE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|