C14H15NO4 — CID 18099294
(2-methoxy-2-oxoethyl) 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 18099294) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (2-methoxy-2-oxoethyl) 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 18099294 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | COC(=O)COC(=O)c1ccc2[nH]c(C)c(C)c2c1 |
| InChI | InChI=1S/C14H15NO4/c1-8-9(2)15-12-5-4-10(6-11(8)12)14(17)19-7-13(16)18-3/h4-6,15H,7H2,1-3H3 |
| InChIKey | RKYIMRHHOFVMJZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|