C18H17NO2 — CID 50888023
benzyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 50888023) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is benzyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | benzyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 50888023 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | benzyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | Cc1[nH]c2ccc(C(=O)OCc3ccccc3)cc2c1C |
| InChI | InChI=1S/C18H17NO2/c1-12-13(2)19-17-9-8-15(10-16(12)17)18(20)21-11-14-6-4-3-5-7-14/h3-10,19H,11H2,1-2H3 |
| InChIKey | VLPUNDTXLHNWOY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|