C18H17NO5 — CID 71920587
(5-methoxy-4-oxopyran-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 71920587) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is (5-methoxy-4-oxopyran-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | (5-methoxy-4-oxopyran-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 71920587 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | (5-methoxy-4-oxopyran-2-yl)methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | COc1coc(COC(=O)c2ccc3[nH]c(C)c(C)c3c2)cc1=O |
| InChI | InChI=1S/C18H17NO5/c1-10-11(2)19-15-5-4-12(6-14(10)15)18(21)24-8-13-7-16(20)17(22-3)9-23-13/h4-7,9,19H,8H2,1-3H3 |
| InChIKey | ZQCPQCMJWCROIS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|