C22H22N6O3 — CID 24523927
[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2,3-dimethyl-1H-indole-5-carboxylate (PubChem CID 24523927) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2,3-dimethyl-1H-indole-5-carboxylate.
| Compound Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2,3-dimethyl-1H-indole-5-carboxylate |
|---|---|
| PubChem CID | 24523927 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2,3-dimethyl-1H-indole-5-carboxylate |
| SMILES | COc1ccccc1Nc1nc(N)nc(COC(=O)c2ccc3[nH]c(C)c(C)c3c2)n1 |
| InChI | InChI=1S/C22H22N6O3/c1-12-13(2)24-16-9-8-14(10-15(12)16)20(29)31-11-19-26-21(23)28-22(27-19)25-17-6-4-5-7-18(17)30-3/h4-10,24H,11H2,1-3H3,(H3,23,25,26,27,28) |
| InChIKey | OGXJJQYRVGHTND-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|