C21H18N6O5 — CID 46641840
[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate (PubChem CID 46641840) has the molecular formula C21H18N6O5 and a molecular weight of 434.41 g/mol. Its IUPAC name is [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 46641840 |
| Molecular Formula | C21H18N6O5 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methyl-1,3-dioxoisoindole-5-carboxylate |
| SMILES | COc1ccccc1Nc1nc(N)nc(COC(=O)c2ccc3c(c2)C(=O)N(C)C3=O)n1 |
| InChI | InChI=1S/C21H18N6O5/c1-27-17(28)12-8-7-11(9-13(12)18(27)29)19(30)32-10-16-24-20(22)26-21(25-16)23-14-5-3-4-6-15(14)31-2/h3-9H,10H2,1-2H3,(H3,22,23,24,25,26) |
| InChIKey | AFQRCNRXSVBINE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 149.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|