C22H23N7O5 — CID 27028101
[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 5-nitro-2-pyrrolidin-1-ylbenzoate (PubChem CID 27028101) has the molecular formula C22H23N7O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 5-nitro-2-pyrrolidin-1-ylbenzoate.
| Compound Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 5-nitro-2-pyrrolidin-1-ylbenzoate |
|---|---|
| PubChem CID | 27028101 |
| Molecular Formula | C22H23N7O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | [4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 5-nitro-2-pyrrolidin-1-ylbenzoate |
| SMILES | COc1ccccc1Nc1nc(N)nc(COC(=O)c2cc([N+](=O)[O-])ccc2N2CCCC2)n1 |
| InChI | InChI=1S/C22H23N7O5/c1-33-18-7-3-2-6-16(18)24-22-26-19(25-21(23)27-22)13-34-20(30)15-12-14(29(31)32)8-9-17(15)28-10-4-5-11-28/h2-3,6-9,12H,4-5,10-11,13H2,1H3,(H3,23,24,25,26,27) |
| InChIKey | BNNOEAAUHKSRLG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 158.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|