C18H18N6O5 — CID 38897966
6-[(2-methoxy-5-nitrophenoxy)methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 38897966) has the molecular formula C18H18N6O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is 6-[(2-methoxy-5-nitrophenoxy)methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2-methoxy-5-nitrophenoxy)methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 38897966 |
| Molecular Formula | C18H18N6O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 6-[(2-methoxy-5-nitrophenoxy)methyl]-2-N-(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccccc1Nc1nc(N)nc(COc2cc([N+](=O)[O-])ccc2OC)n1 |
| InChI | InChI=1S/C18H18N6O5/c1-27-13-6-4-3-5-12(13)20-18-22-16(21-17(19)23-18)10-29-15-9-11(24(25)26)7-8-14(15)28-2/h3-9H,10H2,1-2H3,(H3,19,20,21,22,23) |
| InChIKey | PDAIZFSDYZFIHR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|