C23H23N5O4 — CID 38916991
7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-propylchromen-2-one (PubChem CID 38916991) has the molecular formula C23H23N5O4 and a molecular weight of 433.47 g/mol. Its IUPAC name is 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-propylchromen-2-one.
| Compound Name | 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 38916991 |
| Molecular Formula | C23H23N5O4 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 7-[[4-amino-6-(2-methoxyanilino)-1,3,5-triazin-2-yl]methoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3nc(N)nc(Nc4ccccc4OC)n3)ccc12 |
| InChI | InChI=1S/C23H23N5O4/c1-3-6-14-11-21(29)32-19-12-15(9-10-16(14)19)31-13-20-26-22(24)28-23(27-20)25-17-7-4-5-8-18(17)30-2/h4-5,7-12H,3,6,13H2,1-2H3,(H3,24,25,26,27,28) |
| InChIKey | FXMYXSNEWMEIHP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|