C24H23NO5S — CID 46583293
7-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-propylchromen-2-one (PubChem CID 46583293) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is 7-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-propylchromen-2-one.
| Compound Name | 7-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-propylchromen-2-one |
|---|---|
| PubChem CID | 46583293 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 7-[[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3csc(-c4cccc(OC)c4OC)n3)ccc12 |
| InChI | InChI=1S/C24H23NO5S/c1-4-6-15-11-22(26)30-21-12-17(9-10-18(15)21)29-13-16-14-31-24(25-16)19-7-5-8-20(27-2)23(19)28-3/h5,7-12,14H,4,6,13H2,1-3H3 |
| InChIKey | WSCXHQKQRRXWAJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 70.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|