C26H26N2O4S — CID 38916891
N-(2,3-dimethylphenyl)-N-[4-[(2-oxo-4-propylchromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 38916891) has the molecular formula C26H26N2O4S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-N-[4-[(2-oxo-4-propylchromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-N-[4-[(2-oxo-4-propylchromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 38916891 |
| Molecular Formula | C26H26N2O4S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-(2,3-dimethylphenyl)-N-[4-[(2-oxo-4-propylchromen-7-yl)oxymethyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CCCc1cc(=O)oc2cc(OCc3csc(N(C(C)=O)c4cccc(C)c4C)n3)ccc12 |
| InChI | InChI=1S/C26H26N2O4S/c1-5-7-19-12-25(30)32-24-13-21(10-11-22(19)24)31-14-20-15-33-26(27-20)28(18(4)29)23-9-6-8-16(2)17(23)3/h6,8-13,15H,5,7,14H2,1-4H3 |
| InChIKey | JQYXNBIQDNQETG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|