C20H24N2O3S — CID 56511208
[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl (Z)-2-methylpent-2-enoate (PubChem CID 56511208) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl (Z)-2-methylpent-2-enoate.
| Compound Name | [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl (Z)-2-methylpent-2-enoate |
|---|---|
| PubChem CID | 56511208 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl (Z)-2-methylpent-2-enoate |
| SMILES | CC/C=C(/C)C(=O)OCc1csc(N(C(C)=O)c2cccc(C)c2C)n1 |
| InChI | InChI=1S/C20H24N2O3S/c1-6-8-14(3)19(24)25-11-17-12-26-20(21-17)22(16(5)23)18-10-7-9-13(2)15(18)4/h7-10,12H,6,11H2,1-5H3/b14-8- |
| InChIKey | MPQIFGUYFXEDPT-ZSOIEALJSA-N |
| XLogP | 4.84 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|