C22H23N3O3S — CID 55562461
[2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-amino-3-methylbenzoate (PubChem CID 55562461) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-amino-3-methylbenzoate.
| Compound Name | [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-amino-3-methylbenzoate |
|---|---|
| PubChem CID | 55562461 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [2-(N-acetyl-2,3-dimethylanilino)-1,3-thiazol-4-yl]methyl 2-amino-3-methylbenzoate |
| SMILES | CC(=O)N(c1nc(COC(=O)c2cccc(C)c2N)cs1)c1cccc(C)c1C |
| InChI | InChI=1S/C22H23N3O3S/c1-13-7-6-10-19(15(13)3)25(16(4)26)22-24-17(12-29-22)11-28-21(27)18-9-5-8-14(2)20(18)23/h5-10,12H,11,23H2,1-4H3 |
| InChIKey | XVIDFBTUGAOVIP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|