C22H20N2O4 — CID 51293952
6-methyl-2-[(2-oxo-4-propylchromen-7-yl)oxymethyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 51293952) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 6-methyl-2-[(2-oxo-4-propylchromen-7-yl)oxymethyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 6-methyl-2-[(2-oxo-4-propylchromen-7-yl)oxymethyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 51293952 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 6-methyl-2-[(2-oxo-4-propylchromen-7-yl)oxymethyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3cc(=O)n4c(C)cccc4n3)ccc12 |
| InChI | InChI=1S/C22H20N2O4/c1-3-5-15-10-22(26)28-19-12-17(8-9-18(15)19)27-13-16-11-21(25)24-14(2)6-4-7-20(24)23-16/h4,6-12H,3,5,13H2,1-2H3 |
| InChIKey | QRMHKRCGZGUHHX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|