About 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one
7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one (PubChem CID 112787885) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one.
Molecular Properties
| Compound Name | 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one |
| PubChem CID | 112787885 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one |
| SMILES | CCCc1cc(=O)oc2cc(OCc3cn4cc(C)ccc4n3)ccc12 |
| InChI | InChI=1S/C21H20N2O3/c1-3-4-15-9-21(24)26-19-10-17(6-7-18(15)19)25-13-16-12-23-11-14(2)5-8-20(23)22-16/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | QGGSTBGWUIHCTH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one?
The IUPAC name of 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one (CID 112787885) is 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one.
What is the SMILES notation for 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one?
The canonical SMILES for 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one is CCCc1cc(=O)oc2cc(OCc3cn4cc(C)ccc4n3)ccc12.
What is the InChIKey of 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one?
The InChIKey is QGGSTBGWUIHCTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-3-4-15-9-21(24)26-19-10-17(6-7-18(15)19)25-13-16-12-23-11-14(2)5-8-20(23)22-16/h5-12H,3-4,13H2,1-2H3.
What are the key properties of 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one?
7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one has a molecular weight of 348.40 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(6-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-4-propylchromen-2-one is sourced from PubChem (CID 112787885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).