C20H15ClN2O5 — CID 8858505
(6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate (PubChem CID 8858505) has the molecular formula C20H15ClN2O5 and a molecular weight of 398.80 g/mol. Its IUPAC name is (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate.
| Compound Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
|---|---|
| PubChem CID | 8858505 |
| Molecular Formula | C20H15ClN2O5 |
| Molecular Weight | 398.80 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | (6-chloroimidazo[1,2-a]pyridin-2-yl)methyl 2-(4-methyl-2-oxochromen-7-yl)oxyacetate |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)OCc3cn4cc(Cl)ccc4n3)ccc12 |
| InChI | InChI=1S/C20H15ClN2O5/c1-12-6-19(24)28-17-7-15(3-4-16(12)17)26-11-20(25)27-10-14-9-23-8-13(21)2-5-18(23)22-14/h2-9H,10-11H2,1H3 |
| InChIKey | QSOXOMHJHQYECA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|