C18H12Cl2N2O3 — CID 27015894
6-chloro-7-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-4-methylchromen-2-one (PubChem CID 27015894) has the molecular formula C18H12Cl2N2O3 and a molecular weight of 375.21 g/mol. Its IUPAC name is 6-chloro-7-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 27015894 |
| Molecular Formula | C18H12Cl2N2O3 |
| Molecular Weight | 375.21 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 6-chloro-7-[(6-chloroimidazo[1,2-a]pyridin-2-yl)methoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCc3cn4cc(Cl)ccc4n3)c(Cl)cc12 |
| InChI | InChI=1S/C18H12Cl2N2O3/c1-10-4-18(23)25-15-6-16(14(20)5-13(10)15)24-9-12-8-22-7-11(19)2-3-17(22)21-12/h2-8H,9H2,1H3 |
| InChIKey | YFPHRAYTWVNKTN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|