C21H16ClNO4S — CID 38896838
6-chloro-7-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-methylchromen-2-one (PubChem CID 38896838) has the molecular formula C21H16ClNO4S and a molecular weight of 413.88 g/mol. Its IUPAC name is 6-chloro-7-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-methylchromen-2-one.
| Compound Name | 6-chloro-7-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 38896838 |
| Molecular Formula | C21H16ClNO4S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 6-chloro-7-[[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]methoxy]-4-methylchromen-2-one |
| SMILES | COc1cccc(-c2nc(COc3cc4oc(=O)cc(C)c4cc3Cl)cs2)c1 |
| InChI | InChI=1S/C21H16ClNO4S/c1-12-6-20(24)27-18-9-19(17(22)8-16(12)18)26-10-14-11-28-21(23-14)13-4-3-5-15(7-13)25-2/h3-9,11H,10H2,1-2H3 |
| InChIKey | YQXKFBJOJFMZQJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|