C12H12ClNOS — CID 82088342
4-(2-chloroethyl)-2-(3-methoxyphenyl)-1,3-thiazole (PubChem CID 82088342) has the molecular formula C12H12ClNOS and a molecular weight of 253.75 g/mol. Its IUPAC name is 4-(2-chloroethyl)-2-(3-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(2-chloroethyl)-2-(3-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82088342 |
| Molecular Formula | C12H12ClNOS |
| Molecular Weight | 253.75 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-(2-chloroethyl)-2-(3-methoxyphenyl)-1,3-thiazole |
| SMILES | COc1cccc(-c2nc(CCCl)cs2)c1 |
| InChI | InChI=1S/C12H12ClNOS/c1-15-11-4-2-3-9(7-11)12-14-10(5-6-13)8-16-12/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | GHIRCZSWMCPJOZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|