C18H21N3O3S — CID 110333190
4-[3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]propanoyl]piperazine-1-carbaldehyde (PubChem CID 110333190) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 4-[3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]propanoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]propanoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 110333190 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-[3-[2-(3-methoxyphenyl)-1,3-thiazol-4-yl]propanoyl]piperazine-1-carbaldehyde |
| SMILES | COc1cccc(-c2nc(CCC(=O)N3CCN(C=O)CC3)cs2)c1 |
| InChI | InChI=1S/C18H21N3O3S/c1-24-16-4-2-3-14(11-16)18-19-15(12-25-18)5-6-17(23)21-9-7-20(13-22)8-10-21/h2-4,11-13H,5-10H2,1H3 |
| InChIKey | RIDSQBSSUCTUDN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|