C14H16ClNO2S — CID 103399605
4-(3-chloropropyl)-2-(3,5-dimethoxyphenyl)-1,3-thiazole (PubChem CID 103399605) has the molecular formula C14H16ClNO2S and a molecular weight of 297.81 g/mol. Its IUPAC name is 4-(3-chloropropyl)-2-(3,5-dimethoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(3-chloropropyl)-2-(3,5-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 103399605 |
| Molecular Formula | C14H16ClNO2S |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-(3-chloropropyl)-2-(3,5-dimethoxyphenyl)-1,3-thiazole |
| SMILES | COc1cc(OC)cc(-c2nc(CCCCl)cs2)c1 |
| InChI | InChI=1S/C14H16ClNO2S/c1-17-12-6-10(7-13(8-12)18-2)14-16-11(9-19-14)4-3-5-15/h6-9H,3-5H2,1-2H3 |
| InChIKey | BOBTVOLDAOZDGM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|