C20H15ClN2O4 — CID 39527648
6-chloro-4-methyl-7-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one (PubChem CID 39527648) has the molecular formula C20H15ClN2O4 and a molecular weight of 382.80 g/mol. Its IUPAC name is 6-chloro-4-methyl-7-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one.
| Compound Name | 6-chloro-4-methyl-7-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one |
|---|---|
| PubChem CID | 39527648 |
| Molecular Formula | C20H15ClN2O4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 6-chloro-4-methyl-7-[[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]methoxy]chromen-2-one |
| SMILES | Cc1cccc(-c2nc(COc3cc4oc(=O)cc(C)c4cc3Cl)no2)c1 |
| InChI | InChI=1S/C20H15ClN2O4/c1-11-4-3-5-13(6-11)20-22-18(23-27-20)10-25-17-9-16-14(8-15(17)21)12(2)7-19(24)26-16/h3-9H,10H2,1-2H3 |
| InChIKey | XVVLLZNUTJLEGX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|