C14H11ClN2O4 — CID 38896678
6-chloro-4-methyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one (PubChem CID 38896678) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is 6-chloro-4-methyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one.
| Compound Name | 6-chloro-4-methyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 38896678 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 6-chloro-4-methyl-7-[(5-methyl-1,3,4-oxadiazol-2-yl)methoxy]chromen-2-one |
| SMILES | Cc1nnc(COc2cc3oc(=O)cc(C)c3cc2Cl)o1 |
| InChI | InChI=1S/C14H11ClN2O4/c1-7-3-14(18)21-11-5-12(10(15)4-9(7)11)19-6-13-17-16-8(2)20-13/h3-5H,6H2,1-2H3 |
| InChIKey | NNQXSXRWPSYSOZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|